* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XANTHOHUMOL D |
CAS: | 274675-25-1 |
English Synonyms: | XANTHOHUMOL D |
MDL Number.: | MFCD17214930 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | CC(=C)C(Cc1c(cc(c(c1O)C(=O)/C=C/c2ccc(cc2)O)OC)O)O |
InChi: | InChI=1S/C21H22O6/c1-12(2)17(24)10-15-18(25)11-19(27-3)20(21(15)26)16(23)9-6-13-4-7-14(22)8-5-13/h4-9,11,17,22,24-26H,1,10H2,2-3H3/b9-6+ |
InChiKey: | InChIKey=IIWLGOCXDBSFCM-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.