* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-XANTHENE-9-THIOL |
English Synonyms: | 9H-XANTHENE-9-THIOL |
MDL Number.: | MFCD11641871 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)C(c3ccccc3O2)S |
InChi: | InChI=1S/C13H10OS/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h1-8,13,15H |
InChiKey: | InChIKey=BCZADNSFSRFPNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.