* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XANTHINE, 1,8-DIMETHYL-3-ISOBUTYL- |
CAS: | 63908-28-1 |
English Synonyms: | XANTHINE, 1,8-DIMETHYL-3-ISOBUTYL- |
MDL Number.: | MFCD01694282 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1[nH]c2c(n1)n(c(=O)n(c2=O)C)CC(C)C |
InChi: | InChI=1S/C11H16N4O2/c1-6(2)5-15-9-8(12-7(3)13-9)10(16)14(4)11(15)17/h6H,5H2,1-4H3,(H,12,13) |
InChiKey: | InChIKey=JGULMIZILIGJNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.