* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XR 9051 HCL |
CAS: | 180422-22-4 |
English Synonyms: | XR 9051 HCL |
MDL Number.: | MFCD00952136 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | Cn1/c(=C\c2ccccc2)/c(=O)[nH]/c(=C\c3cccc(c3)C(=O)Nc4ccc(cc4)CCN5CCc6cc(c(cc6C5)OC)OC)/c1=O.Cl |
InChi: | InChI=1S/C39H38N4O5.ClH/c1-42-34(22-27-8-5-4-6-9-27)38(45)41-33(39(42)46)21-28-10-7-11-30(20-28)37(44)40-32-14-12-26(13-15-32)16-18-43-19-17-29-23-35(47-2)36(48-3)24-31(29)25-43;/h4-15,20-24H,16-19,25H2,1-3H3,(H,40,44)(H,41,45);1H/b33-21-,34-22-; |
InChiKey: | InChIKey=NJXUYZIBWDEBQS-VFRXXILGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.