* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Benzenamine, 3-[(5-aminopentyl)oxy]- |
CAS: | 935659-87-3 |
English Synonyms: | BENZENAMINE, 3-[(5-AMINOPENTYL)OXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCCCCOC=1C=C(C=CC1)N |
InChi: | InChI=1S/C11H18N2O/c12-7-2-1-3-8-14-11-6-4-5-10(13)9-11/h4-6,9H,1-3,7-8,12-13H2 |
InChiKey: | InChIKey=KCMHHBWMQJOBKV-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.