* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-2H-PYRIDO[1,2-A]PYRIMIDINE-2,4(3H)-DIONE |
CAS: | 128455-49-2 |
English Synonyms: | 9-CHLORO-2H-PYRIDO[1,2-A]PYRIMIDINE-2,4(3H)-DIONE |
MDL Number.: | MFCD11656296 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C1C(=O)N=C2C(=CC=CN2C1=O)Cl |
InChi: | InChI=1S/C8H5ClN2O2/c9-5-2-1-3-11-7(13)4-6(12)10-8(5)11/h1-3H,4H2 |
InChiKey: | InChIKey=PXSJCZNMHGEBPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.